About (2-methoxy-2-oxoethyl) 2-[4-(quinolin-2-ylmethoxy)phenyl]acetate
(2-methoxy-2-oxoethyl) 2-[4-(quinolin-2-ylmethoxy)phenyl]acetate (PubChem CID 14500249) has the molecular formula C21H19NO5
and a molecular weight of 365.39 g/mol. Its IUPAC name is (2-methoxy-2-oxoethyl) 2-[4-(quinolin-2-ylmethoxy)phenyl]acetate.
Molecular Properties
| Compound Name | (2-methoxy-2-oxoethyl) 2-[4-(quinolin-2-ylmethoxy)phenyl]acetate |
| PubChem CID | 14500249 |
| Molecular Formula | C21H19NO5 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | (2-methoxy-2-oxoethyl) 2-[4-(quinolin-2-ylmethoxy)phenyl]acetate |
| SMILES | COC(=O)COC(=O)Cc1ccc(OCc2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C21H19NO5/c1-25-21(24)14-27-20(23)12-15-6-10-18(11-7-15)26-13-17-9-8-16-4-2-3-5-19(16)22-17/h2-11H,12-14H2,1H3 |
| InChIKey | QSGHMKDJUOSUNS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2-methoxy-2-oxoethyl) 2-[4-(quinolin-2-ylmethoxy)phenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxy-2-oxoethyl) 2-[4-(quinolin-2-ylmethoxy)phenyl]acetate?
The IUPAC name of (2-methoxy-2-oxoethyl) 2-[4-(quinolin-2-ylmethoxy)phenyl]acetate (CID 14500249) is (2-methoxy-2-oxoethyl) 2-[4-(quinolin-2-ylmethoxy)phenyl]acetate.
What is the SMILES notation for (2-methoxy-2-oxoethyl) 2-[4-(quinolin-2-ylmethoxy)phenyl]acetate?
The canonical SMILES for (2-methoxy-2-oxoethyl) 2-[4-(quinolin-2-ylmethoxy)phenyl]acetate is COC(=O)COC(=O)Cc1ccc(OCc2ccc3ccccc3n2)cc1.
What is the InChIKey of (2-methoxy-2-oxoethyl) 2-[4-(quinolin-2-ylmethoxy)phenyl]acetate?
The InChIKey is QSGHMKDJUOSUNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19NO5/c1-25-21(24)14-27-20(23)12-15-6-10-18(11-7-15)26-13-17-9-8-16-4-2-3-5-19(16)22-17/h2-11H,12-14H2,1H3.
What are the key properties of (2-methoxy-2-oxoethyl) 2-[4-(quinolin-2-ylmethoxy)phenyl]acetate?
(2-methoxy-2-oxoethyl) 2-[4-(quinolin-2-ylmethoxy)phenyl]acetate has a molecular weight of 365.39 g/mol, XLogP of 3.07, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxy-2-oxoethyl) 2-[4-(quinolin-2-ylmethoxy)phenyl]acetate is sourced from PubChem (CID 14500249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).