C32H28N2O4 — CID 54314430
methyl 2-[4-[2-[6-(quinolin-2-ylmethoxy)naphthalen-2-yl]propanoylamino]phenyl]acetate (PubChem CID 54314430) has the molecular formula C32H28N2O4 and a molecular weight of 504.59 g/mol. Its IUPAC name is methyl 2-[4-[2-[6-(quinolin-2-ylmethoxy)naphthalen-2-yl]propanoylamino]phenyl]acetate.
| Compound Name | methyl 2-[4-[2-[6-(quinolin-2-ylmethoxy)naphthalen-2-yl]propanoylamino]phenyl]acetate |
|---|---|
| PubChem CID | 54314430 |
| Molecular Formula | C32H28N2O4 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | methyl 2-[4-[2-[6-(quinolin-2-ylmethoxy)naphthalen-2-yl]propanoylamino]phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(NC(=O)C(C)c2ccc3cc(OCc4ccc5ccccc5n4)ccc3c2)cc1 |
| InChI | InChI=1S/C32H28N2O4/c1-21(32(36)34-27-13-7-22(8-14-27)17-31(35)37-2)24-9-10-26-19-29(16-12-25(26)18-24)38-20-28-15-11-23-5-3-4-6-30(23)33-28/h3-16,18-19,21H,17,20H2,1-2H3,(H,34,36) |
| InChIKey | SNDRKFJLIKVDPU-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |