C42H58O12Si — CID 173474089
tris(2,3,4,6-tetramethoxy-5-methylphenyl)-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 173474089) has the molecular formula C42H58O12Si and a molecular weight of 783.00 g/mol. Its IUPAC name is tris(2,3,4,6-tetramethoxy-5-methylphenyl)-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | tris(2,3,4,6-tetramethoxy-5-methylphenyl)-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 173474089 |
| Molecular Formula | C42H58O12Si |
| Molecular Weight | 783.00 g/mol |
| Exact Mass | 782.37 |
| IUPAC Name | tris(2,3,4,6-tetramethoxy-5-methylphenyl)-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | COc1c(C)c(OC)c([Si](c2c(OC)c(C)c(OC)c(OC)c2OC)(c2c(OC)c(C)c(OC)c(OC)c2OC)C2(C)C=C(C)C(C)=C2C)c(OC)c1OC |
| InChI | InChI=1S/C42H58O12Si/c1-21-20-42(7,26(6)22(21)2)55(39-30(46-11)23(3)27(43-8)33(49-14)36(39)52-17,40-31(47-12)24(4)28(44-9)34(50-15)37(40)53-18)41-32(48-13)25(5)29(45-10)35(51-16)38(41)54-19/h20H,1-19H3 |
| InChIKey | VNAZZOSATWYQLK-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.00 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|