C42H58O9Si — CID 173473706
(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)-tris(2,4,5-trimethoxy-3,6-dimethylphenyl)silane (PubChem CID 173473706) has the molecular formula C42H58O9Si and a molecular weight of 735.00 g/mol. Its IUPAC name is (2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)-tris(2,4,5-trimethoxy-3,6-dimethylphenyl)silane.
| Compound Name | (2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)-tris(2,4,5-trimethoxy-3,6-dimethylphenyl)silane |
|---|---|
| PubChem CID | 173473706 |
| Molecular Formula | C42H58O9Si |
| Molecular Weight | 735.00 g/mol |
| Exact Mass | 734.39 |
| IUPAC Name | (2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)-tris(2,4,5-trimethoxy-3,6-dimethylphenyl)silane |
| SMILES | COc1c(C)c(OC)c([Si](c2c(C)c(OC)c(OC)c(C)c2OC)(c2c(C)c(OC)c(OC)c(C)c2OC)C2C(C)=C(C)C(C)=C2C)c(C)c1OC |
| InChI | InChI=1S/C42H58O9Si/c1-20-21(2)23(4)39(22(20)3)52(40-27(8)33(46-14)30(43-11)24(5)36(40)49-17,41-28(9)34(47-15)31(44-12)25(6)37(41)50-18)42-29(10)35(48-16)32(45-13)26(7)38(42)51-19/h39H,1-19H3 |
| InChIKey | PSWJMNITQWDFHL-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.00 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|