C18H27NOSi — CID 131720370
N-[dimethyl-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silyl]-2-methoxyaniline (PubChem CID 131720370) has the molecular formula C18H27NOSi and a molecular weight of 301.51 g/mol. Its IUPAC name is N-[dimethyl-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silyl]-2-methoxyaniline.
| Compound Name | N-[dimethyl-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silyl]-2-methoxyaniline |
|---|---|
| PubChem CID | 131720370 |
| Molecular Formula | C18H27NOSi |
| Molecular Weight | 301.51 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | N-[dimethyl-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silyl]-2-methoxyaniline |
| SMILES | COc1ccccc1N[Si](C)(C)C1(C)C=C(C)C(C)=C1C |
| InChI | InChI=1S/C18H27NOSi/c1-13-12-18(4,15(3)14(13)2)21(6,7)19-16-10-8-9-11-17(16)20-5/h8-12,19H,1-7H3 |
| InChIKey | SIDJDBWKLCWPSY-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.51 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|