C12H15N3O — CID 175855510
N-(2-methoxyphenyl)-2,4-dimethylimidazol-1-amine (PubChem CID 175855510) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-2,4-dimethylimidazol-1-amine.
| Compound Name | N-(2-methoxyphenyl)-2,4-dimethylimidazol-1-amine |
|---|---|
| PubChem CID | 175855510 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | N-(2-methoxyphenyl)-2,4-dimethylimidazol-1-amine |
| SMILES | COc1ccccc1Nn1cc(C)nc1C |
| InChI | InChI=1S/C12H15N3O/c1-9-8-15(10(2)13-9)14-11-6-4-5-7-12(11)16-3/h4-8,14H,1-3H3 |
| InChIKey | MRCIJIGFLINYJS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |