C39H52O9Si — CID 173473797
(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)-tris(3,4,6-trimethoxy-2-methylphenyl)silane (PubChem CID 173473797) has the molecular formula C39H52O9Si and a molecular weight of 692.92 g/mol. Its IUPAC name is (1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)-tris(3,4,6-trimethoxy-2-methylphenyl)silane.
| Compound Name | (1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)-tris(3,4,6-trimethoxy-2-methylphenyl)silane |
|---|---|
| PubChem CID | 173473797 |
| Molecular Formula | C39H52O9Si |
| Molecular Weight | 692.92 g/mol |
| Exact Mass | 692.34 |
| IUPAC Name | (1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)-tris(3,4,6-trimethoxy-2-methylphenyl)silane |
| SMILES | COc1cc(OC)c([Si](c2c(OC)cc(OC)c(OC)c2C)(c2c(OC)cc(OC)c(OC)c2C)C2(C)C=C(C)C(C)=C2C)c(C)c1OC |
| InChI | InChI=1S/C39H52O9Si/c1-21-20-39(7,26(6)22(21)2)49(36-23(3)33(46-14)27(40-8)17-30(36)43-11,37-24(4)34(47-15)28(41-9)18-31(37)44-12)38-25(5)35(48-16)29(42-10)19-32(38)45-13/h17-20H,1-16H3 |
| InChIKey | FZPMSDSNIVHPLS-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.92 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|