C33H40Si — CID 173473760
(3,5-diethylphenyl)-(2,4-dimethylphenyl)-phenyl-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 173473760) has the molecular formula C33H40Si and a molecular weight of 464.77 g/mol. Its IUPAC name is (3,5-diethylphenyl)-(2,4-dimethylphenyl)-phenyl-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | (3,5-diethylphenyl)-(2,4-dimethylphenyl)-phenyl-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 173473760 |
| Molecular Formula | C33H40Si |
| Molecular Weight | 464.77 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | (3,5-diethylphenyl)-(2,4-dimethylphenyl)-phenyl-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CCc1cc(CC)cc([Si](c2ccccc2)(c2ccc(C)cc2C)C2(C)C=C(C)C(C)=C2C)c1 |
| InChI | InChI=1S/C33H40Si/c1-9-28-19-29(10-2)21-31(20-28)34(30-14-12-11-13-15-30,32-17-16-23(3)18-24(32)4)33(8)22-25(5)26(6)27(33)7/h11-22H,9-10H2,1-8H3 |
| InChIKey | GPDTZXWDCXMEFO-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.77 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|