C99H76Si — CID 173473215
(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)-tris(2,3,5,6-tetraphenylphenyl)silane (PubChem CID 173473215) has the molecular formula C99H76Si and a molecular weight of 1293.78 g/mol. Its IUPAC name is (1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)-tris(2,3,5,6-tetraphenylphenyl)silane.
| Compound Name | (1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)-tris(2,3,5,6-tetraphenylphenyl)silane |
|---|---|
| PubChem CID | 173473215 |
| Molecular Formula | C99H76Si |
| Molecular Weight | 1293.78 g/mol |
| Exact Mass | 1292.57 |
| IUPAC Name | (1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)-tris(2,3,5,6-tetraphenylphenyl)silane |
| SMILES | CC1=CC(C)([Si](c2c(-c3ccccc3)c(-c3ccccc3)cc(-c3ccccc3)c2-c2ccccc2)(c2c(-c3ccccc3)c(-c3ccccc3)cc(-c3ccccc3)c2-c2ccccc2)c2c(-c3ccccc3)c(-c3ccccc3)cc(-c3ccccc3)c2-c2ccccc2)C(C)=C1C |
| InChI | InChI=1S/C99H76Si/c1-69-68-99(4,71(3)70(69)2)100(96-90(78-53-29-11-30-54-78)84(72-41-17-5-18-42-72)65-85(73-43-19-6-20-44-73)91(96)79-55-31-12-32-56-79,97-92(80-57-33-13-34-58-80)86(74-45-21-7-22-46-74)66-87(75-47-23-8-24-48-75)93(97)81-59-35-14-36-60-81)98-94(82-61-37-15-38-62-82)88(76-49-25-9-26-50-76)67-89(77-51-27-10-28-52-77)95(98)83-63-39-16-40-64-83/h5-68H,1-4H3 |
| InChIKey | WLZPEPRZZNYATR-UHFFFAOYSA-N |
| XLogP | 25.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 100 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1293.78 |
| LogP ≤ 5 | 25.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|