C66H58Si — CID 173473344
tris(4-methyl-2,5-diphenylphenyl)-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 173473344) has the molecular formula C66H58Si and a molecular weight of 879.28 g/mol. Its IUPAC name is tris(4-methyl-2,5-diphenylphenyl)-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | tris(4-methyl-2,5-diphenylphenyl)-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 173473344 |
| Molecular Formula | C66H58Si |
| Molecular Weight | 879.28 g/mol |
| Exact Mass | 878.43 |
| IUPAC Name | tris(4-methyl-2,5-diphenylphenyl)-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CC1=CC(C)([Si](c2cc(-c3ccccc3)c(C)cc2-c2ccccc2)(c2cc(-c3ccccc3)c(C)cc2-c2ccccc2)c2cc(-c3ccccc3)c(C)cc2-c2ccccc2)C(C)=C1C |
| InChI | InChI=1S/C66H58Si/c1-45-38-60(54-32-20-11-21-33-54)63(41-57(45)51-26-14-8-15-27-51)67(66(7)44-48(4)49(5)50(66)6,64-42-58(52-28-16-9-17-29-52)46(2)39-61(64)55-34-22-12-23-35-55)65-43-59(53-30-18-10-19-31-53)47(3)40-62(65)56-36-24-13-25-37-56/h8-44H,1-7H3 |
| InChIKey | YIZLPSQQOKPDDR-UHFFFAOYSA-N |
| XLogP | 16.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.28 |
| LogP ≤ 5 | 16.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|