C42H48Si — CID 139604324
(2,7-ditert-butyl-9H-fluoren-9-yl)-diphenyl-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 139604324) has the molecular formula C42H48Si and a molecular weight of 580.93 g/mol. Its IUPAC name is (2,7-ditert-butyl-9H-fluoren-9-yl)-diphenyl-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | (2,7-ditert-butyl-9H-fluoren-9-yl)-diphenyl-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 139604324 |
| Molecular Formula | C42H48Si |
| Molecular Weight | 580.93 g/mol |
| Exact Mass | 580.35 |
| IUPAC Name | (2,7-ditert-butyl-9H-fluoren-9-yl)-diphenyl-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CC1=CC(C)([Si](c2ccccc2)(c2ccccc2)C2c3cc(C(C)(C)C)ccc3-c3ccc(C(C)(C)C)cc32)C(C)=C1C |
| InChI | InChI=1S/C42H48Si/c1-28-27-42(10,30(3)29(28)2)43(33-17-13-11-14-18-33,34-19-15-12-16-20-34)39-37-25-31(40(4,5)6)21-23-35(37)36-24-22-32(26-38(36)39)41(7,8)9/h11-27,39H,1-10H3 |
| InChIKey | GJZMOEYJANSTBE-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.93 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|