C42H42Si — CID 102398546
(2,7-ditert-butyl-9H-fluoren-9-yl)-(1H-inden-1-yl)-diphenylsilane (PubChem CID 102398546) has the molecular formula C42H42Si and a molecular weight of 574.88 g/mol. Its IUPAC name is (2,7-ditert-butyl-9H-fluoren-9-yl)-(1H-inden-1-yl)-diphenylsilane.
| Compound Name | (2,7-ditert-butyl-9H-fluoren-9-yl)-(1H-inden-1-yl)-diphenylsilane |
|---|---|
| PubChem CID | 102398546 |
| Molecular Formula | C42H42Si |
| Molecular Weight | 574.88 g/mol |
| Exact Mass | 574.31 |
| IUPAC Name | (2,7-ditert-butyl-9H-fluoren-9-yl)-(1H-inden-1-yl)-diphenylsilane |
| SMILES | CC(C)(C)c1ccc2c(c1)C([Si](c1ccccc1)(c1ccccc1)C1C=Cc3ccccc31)c1cc(C(C)(C)C)ccc1-2 |
| InChI | InChI=1S/C42H42Si/c1-41(2,3)30-22-24-35-36-25-23-31(42(4,5)6)28-38(36)40(37(35)27-30)43(32-16-9-7-10-17-32,33-18-11-8-12-19-33)39-26-21-29-15-13-14-20-34(29)39/h7-28,39-40H,1-6H3 |
| InChIKey | VHWYVNRZLGVWAX-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.88 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|