C46H48 — CID 139937266
2,7-ditert-butyl-9-[diphenyl-(7-propan-2-yl-1H-inden-1-yl)methyl]-9H-fluorene (PubChem CID 139937266) has the molecular formula C46H48 and a molecular weight of 600.89 g/mol. Its IUPAC name is 2,7-ditert-butyl-9-[diphenyl-(7-propan-2-yl-1H-inden-1-yl)methyl]-9H-fluorene.
| Compound Name | 2,7-ditert-butyl-9-[diphenyl-(7-propan-2-yl-1H-inden-1-yl)methyl]-9H-fluorene |
|---|---|
| PubChem CID | 139937266 |
| Molecular Formula | C46H48 |
| Molecular Weight | 600.89 g/mol |
| Exact Mass | 600.38 |
| IUPAC Name | 2,7-ditert-butyl-9-[diphenyl-(7-propan-2-yl-1H-inden-1-yl)methyl]-9H-fluorene |
| SMILES | CC(C)c1cccc2c1C(C(c1ccccc1)(c1ccccc1)C1c3cc(C(C)(C)C)ccc3-c3ccc(C(C)(C)C)cc31)C=C2 |
| InChI | InChI=1S/C46H48/c1-30(2)36-21-15-16-31-22-27-41(42(31)36)46(32-17-11-9-12-18-32,33-19-13-10-14-20-33)43-39-28-34(44(3,4)5)23-25-37(39)38-26-24-35(29-40(38)43)45(6,7)8/h9-30,41,43H,1-8H3 |
| InChIKey | WUTUJOXGOWDCHZ-UHFFFAOYSA-N |
| XLogP | 12.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.89 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |