C49H46 — CID 139937068
2,7-ditert-butyl-9-[diphenyl-(7-phenyl-1H-inden-1-yl)methyl]-9H-fluorene (PubChem CID 139937068) has the molecular formula C49H46 and a molecular weight of 634.91 g/mol. Its IUPAC name is 2,7-ditert-butyl-9-[diphenyl-(7-phenyl-1H-inden-1-yl)methyl]-9H-fluorene.
| Compound Name | 2,7-ditert-butyl-9-[diphenyl-(7-phenyl-1H-inden-1-yl)methyl]-9H-fluorene |
|---|---|
| PubChem CID | 139937068 |
| Molecular Formula | C49H46 |
| Molecular Weight | 634.91 g/mol |
| Exact Mass | 634.36 |
| IUPAC Name | 2,7-ditert-butyl-9-[diphenyl-(7-phenyl-1H-inden-1-yl)methyl]-9H-fluorene |
| SMILES | CC(C)(C)c1ccc2c(c1)C(C(c1ccccc1)(c1ccccc1)C1C=Cc3cccc(-c4ccccc4)c31)c1cc(C(C)(C)C)ccc1-2 |
| InChI | InChI=1S/C49H46/c1-47(2,3)37-26-28-40-41-29-27-38(48(4,5)6)32-43(41)46(42(40)31-37)49(35-20-12-8-13-21-35,36-22-14-9-15-23-36)44-30-25-34-19-16-24-39(45(34)44)33-17-10-7-11-18-33/h7-32,44,46H,1-6H3 |
| InChIKey | ZDXPJIAWQGLIAQ-UHFFFAOYSA-N |
| XLogP | 12.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.91 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |