C20H26Si — CID 139716357
(3-tert-butylcyclopenta-1,3-dien-1-yl)-(1H-inden-1-yl)-dimethylsilane (PubChem CID 139716357) has the molecular formula C20H26Si and a molecular weight of 294.51 g/mol. Its IUPAC name is (3-tert-butylcyclopenta-1,3-dien-1-yl)-(1H-inden-1-yl)-dimethylsilane.
| Compound Name | (3-tert-butylcyclopenta-1,3-dien-1-yl)-(1H-inden-1-yl)-dimethylsilane |
|---|---|
| PubChem CID | 139716357 |
| Molecular Formula | C20H26Si |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | (3-tert-butylcyclopenta-1,3-dien-1-yl)-(1H-inden-1-yl)-dimethylsilane |
| SMILES | CC(C)(C)C1=CCC([Si](C)(C)C2C=Cc3ccccc32)=C1 |
| InChI | InChI=1S/C20H26Si/c1-20(2,3)16-11-12-17(14-16)21(4,5)19-13-10-15-8-6-7-9-18(15)19/h6-11,13-14,19H,12H2,1-5H3 |
| InChIKey | FVBAXFSQAQGIIA-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|