C27H36Si — CID 173473927
tert-butyl-(3,5-dimethylphenyl)-phenyl-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 173473927) has the molecular formula C27H36Si and a molecular weight of 388.67 g/mol. Its IUPAC name is tert-butyl-(3,5-dimethylphenyl)-phenyl-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | tert-butyl-(3,5-dimethylphenyl)-phenyl-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 173473927 |
| Molecular Formula | C27H36Si |
| Molecular Weight | 388.67 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | tert-butyl-(3,5-dimethylphenyl)-phenyl-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CC1=CC(C)([Si](c2ccccc2)(c2cc(C)cc(C)c2)C(C)(C)C)C(C)=C1C |
| InChI | InChI=1S/C27H36Si/c1-19-15-20(2)17-25(16-19)28(26(6,7)8,24-13-11-10-12-14-24)27(9)18-21(3)22(4)23(27)5/h10-18H,1-9H3 |
| InChIKey | LRZSDQSPXDCZLN-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.67 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|