C20H30Si — CID 173473069
methyl-(2-methylpropyl)-phenyl-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 173473069) has the molecular formula C20H30Si and a molecular weight of 298.55 g/mol. Its IUPAC name is methyl-(2-methylpropyl)-phenyl-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | methyl-(2-methylpropyl)-phenyl-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 173473069 |
| Molecular Formula | C20H30Si |
| Molecular Weight | 298.55 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | methyl-(2-methylpropyl)-phenyl-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CC1=CC(C)([Si](C)(CC(C)C)c2ccccc2)C(C)=C1C |
| InChI | InChI=1S/C20H30Si/c1-15(2)14-21(7,19-11-9-8-10-12-19)20(6)13-16(3)17(4)18(20)5/h8-13,15H,14H2,1-7H3 |
| InChIKey | VAJNBRXWAYKOGE-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.55 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|