C12H21ClSi — CID 54061526
chloromethyl-dimethyl-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 54061526) has the molecular formula C12H21ClSi and a molecular weight of 228.84 g/mol. Its IUPAC name is chloromethyl-dimethyl-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | chloromethyl-dimethyl-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 54061526 |
| Molecular Formula | C12H21ClSi |
| Molecular Weight | 228.84 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | chloromethyl-dimethyl-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CC1=CC(C)([Si](C)(C)CCl)C(C)=C1C |
| InChI | InChI=1S/C12H21ClSi/c1-9-7-12(4,11(3)10(9)2)14(5,6)8-13/h7H,8H2,1-6H3 |
| InChIKey | MABMOCMCHRCJJT-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.84 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|