C48H82Si7 — CID 173474943
tris[3-methyl-2,4-bis(trimethylsilyl)phenyl]-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 173474943) has the molecular formula C48H82Si7 and a molecular weight of 855.79 g/mol. Its IUPAC name is tris[3-methyl-2,4-bis(trimethylsilyl)phenyl]-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | tris[3-methyl-2,4-bis(trimethylsilyl)phenyl]-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 173474943 |
| Molecular Formula | C48H82Si7 |
| Molecular Weight | 855.79 g/mol |
| Exact Mass | 854.48 |
| IUPAC Name | tris[3-methyl-2,4-bis(trimethylsilyl)phenyl]-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CC1=CC(C)([Si](c2ccc([Si](C)(C)C)c(C)c2[Si](C)(C)C)(c2ccc([Si](C)(C)C)c(C)c2[Si](C)(C)C)c2ccc([Si](C)(C)C)c(C)c2[Si](C)(C)C)C(C)=C1C |
| InChI | InChI=1S/C48H82Si7/c1-33-32-48(7,38(6)34(33)2)55(42-29-26-39(49(8,9)10)35(3)45(42)52(17,18)19,43-30-27-40(50(11,12)13)36(4)46(43)53(20,21)22)44-31-28-41(51(14,15)16)37(5)47(44)54(23,24)25/h26-32H,1-25H3 |
| InChIKey | WPWBZOCDCIBJSX-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.79 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|