C45H76Si7 — CID 140632052
tris[2,5-bis(trimethylsilyl)phenyl]-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane (PubChem CID 140632052) has the molecular formula C45H76Si7 and a molecular weight of 813.70 g/mol. Its IUPAC name is tris[2,5-bis(trimethylsilyl)phenyl]-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane.
| Compound Name | tris[2,5-bis(trimethylsilyl)phenyl]-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane |
|---|---|
| PubChem CID | 140632052 |
| Molecular Formula | C45H76Si7 |
| Molecular Weight | 813.70 g/mol |
| Exact Mass | 812.43 |
| IUPAC Name | tris[2,5-bis(trimethylsilyl)phenyl]-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane |
| SMILES | CC1=C(C)C(C)C([Si](c2cc([Si](C)(C)C)ccc2[Si](C)(C)C)(c2cc([Si](C)(C)C)ccc2[Si](C)(C)C)c2cc([Si](C)(C)C)ccc2[Si](C)(C)C)=C1C |
| InChI | InChI=1S/C45H76Si7/c1-32-33(2)35(4)45(34(32)3)52(42-29-36(46(5,6)7)23-26-39(42)49(14,15)16,43-30-37(47(8,9)10)24-27-40(43)50(17,18)19)44-31-38(48(11,12)13)25-28-41(44)51(20,21)22/h23-31,34H,1-22H3 |
| InChIKey | WVTOFUWKMKCCGC-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.70 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|