C32H40Si2 — CID 123948663
trimethyl-[3-methyl-5-[(2-methylphenyl)-phenyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silyl]phenyl]silane (PubChem CID 123948663) has the molecular formula C32H40Si2 and a molecular weight of 480.84 g/mol. Its IUPAC name is trimethyl-[3-methyl-5-[(2-methylphenyl)-phenyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silyl]phenyl]silane.
| Compound Name | trimethyl-[3-methyl-5-[(2-methylphenyl)-phenyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silyl]phenyl]silane |
|---|---|
| PubChem CID | 123948663 |
| Molecular Formula | C32H40Si2 |
| Molecular Weight | 480.84 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | trimethyl-[3-methyl-5-[(2-methylphenyl)-phenyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silyl]phenyl]silane |
| SMILES | CC1=C(C)C(C)C([Si](c2ccccc2)(c2cc(C)cc([Si](C)(C)C)c2)c2ccccc2C)=C1C |
| InChI | InChI=1S/C32H40Si2/c1-22-19-29(33(7,8)9)21-30(20-22)34(28-16-11-10-12-17-28,31-18-14-13-15-23(31)2)32-26(5)24(3)25(4)27(32)6/h10-21,26H,1-9H3 |
| InChIKey | PKEWHHIFLXQZJY-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.84 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|