C31H36Si — CID 123456533
(2,3-dimethylphenyl)-(3,5-dimethylphenyl)-phenyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane (PubChem CID 123456533) has the molecular formula C31H36Si and a molecular weight of 436.72 g/mol. Its IUPAC name is (2,3-dimethylphenyl)-(3,5-dimethylphenyl)-phenyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane.
| Compound Name | (2,3-dimethylphenyl)-(3,5-dimethylphenyl)-phenyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane |
|---|---|
| PubChem CID | 123456533 |
| Molecular Formula | C31H36Si |
| Molecular Weight | 436.72 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | (2,3-dimethylphenyl)-(3,5-dimethylphenyl)-phenyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane |
| SMILES | CC1=C(C)C(C)C([Si](c2ccccc2)(c2cc(C)cc(C)c2)c2cccc(C)c2C)=C1C |
| InChI | InChI=1S/C31H36Si/c1-20-17-21(2)19-29(18-20)32(28-14-10-9-11-15-28,30-16-12-13-22(3)23(30)4)31-26(7)24(5)25(6)27(31)8/h9-19,26H,1-8H3 |
| InChIKey | DRZYTBZUKKVTHJ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.72 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|