C53H48Si — CID 123824449
(3,5-dimethylphenyl)-bis(3,5-diphenylphenyl)-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane (PubChem CID 123824449) has the molecular formula C53H48Si and a molecular weight of 713.05 g/mol. Its IUPAC name is (3,5-dimethylphenyl)-bis(3,5-diphenylphenyl)-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane.
| Compound Name | (3,5-dimethylphenyl)-bis(3,5-diphenylphenyl)-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane |
|---|---|
| PubChem CID | 123824449 |
| Molecular Formula | C53H48Si |
| Molecular Weight | 713.05 g/mol |
| Exact Mass | 712.35 |
| IUPAC Name | (3,5-dimethylphenyl)-bis(3,5-diphenylphenyl)-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane |
| SMILES | CC1=C(C)C(C)C([Si](c2cc(C)cc(C)c2)(c2cc(-c3ccccc3)cc(-c3ccccc3)c2)c2cc(-c3ccccc3)cc(-c3ccccc3)c2)=C1C |
| InChI | InChI=1S/C53H48Si/c1-36-27-37(2)29-50(28-36)54(53-40(5)38(3)39(4)41(53)6,51-32-46(42-19-11-7-12-20-42)30-47(33-51)43-21-13-8-14-22-43)52-34-48(44-23-15-9-16-24-44)31-49(35-52)45-25-17-10-18-26-45/h7-35,40H,1-6H3 |
| InChIKey | PNRANYUCKFEVLZ-UHFFFAOYSA-N |
| XLogP | 12.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.05 |
| LogP ≤ 5 | 12.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|