C102H82Si — CID 123940092
tris(3-methyl-2,4,5,6-tetraphenylphenyl)-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane (PubChem CID 123940092) has the molecular formula C102H82Si and a molecular weight of 1335.86 g/mol. Its IUPAC name is tris(3-methyl-2,4,5,6-tetraphenylphenyl)-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane.
| Compound Name | tris(3-methyl-2,4,5,6-tetraphenylphenyl)-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane |
|---|---|
| PubChem CID | 123940092 |
| Molecular Formula | C102H82Si |
| Molecular Weight | 1335.86 g/mol |
| Exact Mass | 1334.62 |
| IUPAC Name | tris(3-methyl-2,4,5,6-tetraphenylphenyl)-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane |
| SMILES | CC1=C(C)C(C)C([Si](c2c(-c3ccccc3)c(C)c(-c3ccccc3)c(-c3ccccc3)c2-c2ccccc2)(c2c(-c3ccccc3)c(C)c(-c3ccccc3)c(-c3ccccc3)c2-c2ccccc2)c2c(-c3ccccc3)c(C)c(-c3ccccc3)c(-c3ccccc3)c2-c2ccccc2)=C1C |
| InChI | InChI=1S/C102H82Si/c1-68-69(2)71(4)99(70(68)3)103(100-90(78-50-26-11-27-51-78)72(5)87(75-44-20-8-21-45-75)93(81-56-32-14-33-57-81)96(100)84-62-38-17-39-63-84,101-91(79-52-28-12-29-53-79)73(6)88(76-46-22-9-23-47-76)94(82-58-34-15-35-59-82)97(101)85-64-40-18-41-65-85)102-92(80-54-30-13-31-55-80)74(7)89(77-48-24-10-25-49-77)95(83-60-36-16-37-61-83)98(102)86-66-42-19-43-67-86/h8-67,70H,1-7H3 |
| InChIKey | LTKJZSJJLPPETN-UHFFFAOYSA-N |
| XLogP | 25.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 103 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1335.86 |
| LogP ≤ 5 | 25.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|