C34H44Si2 — CID 123169075
(2,6-dimethylphenyl)-(2,5-dimethyl-3-trimethylsilylphenyl)-phenyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane (PubChem CID 123169075) has the molecular formula C34H44Si2 and a molecular weight of 508.90 g/mol. Its IUPAC name is (2,6-dimethylphenyl)-(2,5-dimethyl-3-trimethylsilylphenyl)-phenyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane.
| Compound Name | (2,6-dimethylphenyl)-(2,5-dimethyl-3-trimethylsilylphenyl)-phenyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane |
|---|---|
| PubChem CID | 123169075 |
| Molecular Formula | C34H44Si2 |
| Molecular Weight | 508.90 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | (2,6-dimethylphenyl)-(2,5-dimethyl-3-trimethylsilylphenyl)-phenyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane |
| SMILES | CC1=C(C)C(C)C([Si](c2ccccc2)(c2cc(C)cc([Si](C)(C)C)c2C)c2c(C)cccc2C)=C1C |
| InChI | InChI=1S/C34H44Si2/c1-22-20-31(35(9,10)11)29(8)32(21-22)36(30-18-13-12-14-19-30,33-23(2)16-15-17-24(33)3)34-27(6)25(4)26(5)28(34)7/h12-21,27H,1-11H3 |
| InChIKey | PRZNHMISWFGNRI-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.90 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|