C13H20N2O4 — CID 107731050
N-ethyl-N-methyl-2-[(2,3,4-trihydroxyphenyl)methylamino]propanamide (PubChem CID 107731050) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is N-ethyl-N-methyl-2-[(2,3,4-trihydroxyphenyl)methylamino]propanamide.
| Compound Name | N-ethyl-N-methyl-2-[(2,3,4-trihydroxyphenyl)methylamino]propanamide |
|---|---|
| PubChem CID | 107731050 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | N-ethyl-N-methyl-2-[(2,3,4-trihydroxyphenyl)methylamino]propanamide |
| SMILES | CCN(C)C(=O)C(C)NCc1ccc(O)c(O)c1O |
| InChI | InChI=1S/C13H20N2O4/c1-4-15(3)13(19)8(2)14-7-9-5-6-10(16)12(18)11(9)17/h5-6,8,14,16-18H,4,7H2,1-3H3 |
| InChIKey | WFWYBQOLBBNENL-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|