C14H21ClN4O2 — CID 103110690
2-[[2-chloro-4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]methylamino]-N-ethyl-N-methylpropanamide (PubChem CID 103110690) has the molecular formula C14H21ClN4O2 and a molecular weight of 312.80 g/mol. Its IUPAC name is 2-[[2-chloro-4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]methylamino]-N-ethyl-N-methylpropanamide.
| Compound Name | 2-[[2-chloro-4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]methylamino]-N-ethyl-N-methylpropanamide |
|---|---|
| PubChem CID | 103110690 |
| Molecular Formula | C14H21ClN4O2 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 2-[[2-chloro-4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]methylamino]-N-ethyl-N-methylpropanamide |
| SMILES | CCN(C)C(=O)C(C)NCc1ccc(/C(N)=N/O)cc1Cl |
| InChI | InChI=1S/C14H21ClN4O2/c1-4-19(3)14(20)9(2)17-8-11-6-5-10(7-12(11)15)13(16)18-21/h5-7,9,17,21H,4,8H2,1-3H3,(H2,16,18) |
| InChIKey | KYRLWAMDNQKLEV-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|