C12H18ClN3O2S — CID 102667469
3-chloro-N'-hydroxy-4-[(2-methylsulfinylpropylamino)methyl]benzenecarboximidamide (PubChem CID 102667469) has the molecular formula C12H18ClN3O2S and a molecular weight of 303.81 g/mol. Its IUPAC name is 3-chloro-N'-hydroxy-4-[(2-methylsulfinylpropylamino)methyl]benzenecarboximidamide.
| Compound Name | 3-chloro-N'-hydroxy-4-[(2-methylsulfinylpropylamino)methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 102667469 |
| Molecular Formula | C12H18ClN3O2S |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 3-chloro-N'-hydroxy-4-[(2-methylsulfinylpropylamino)methyl]benzenecarboximidamide |
| SMILES | CC(CNCc1ccc(/C(N)=N/O)cc1Cl)S(C)=O |
| InChI | InChI=1S/C12H18ClN3O2S/c1-8(19(2)18)6-15-7-10-4-3-9(5-11(10)13)12(14)16-17/h3-5,8,15,17H,6-7H2,1-2H3,(H2,14,16) |
| InChIKey | RQKIEXPPQUMESS-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|