methyl 2-[2-chloro-4-(N'-hydroxycarbamimidoyl)phenyl]acetate

C10H11ClN2O3 — CID 86683498

IUPACmethyl 2-[2-chloro-4-(N'-hydroxycarbamimidoyl)phenyl]acetate
SMILESCOC(=O)Cc1ccc(C(N)=NO)cc1Cl
InChIInChI=1S/C10H11ClN2O3/c1-16-9(14)5-6-2-3-7(4-8(6)11)10(12)13-15/h2-4,15H,5H2,1H3,(H2,12,13)
InChIKeyCBGAZBHCFLDYJU-UHFFFAOYSA-N
MW242.66 g/mol
LogP1.15
Rot. Bonds3

About methyl 2-[2-chloro-4-(N'-hydroxycarbamimidoyl)phenyl]acetate

methyl 2-[2-chloro-4-(N'-hydroxycarbamimidoyl)phenyl]acetate (PubChem CID 86683498) has the molecular formula C10H11ClN2O3 and a molecular weight of 242.66 g/mol. Its IUPAC name is methyl 2-[2-chloro-4-(N'-hydroxycarbamimidoyl)phenyl]acetate.

Molecular Properties

Compound Namemethyl 2-[2-chloro-4-(N'-hydroxycarbamimidoyl)phenyl]acetate
PubChem CID86683498
Molecular FormulaC10H11ClN2O3
Molecular Weight242.66 g/mol
Exact Mass242.05
IUPAC Namemethyl 2-[2-chloro-4-(N'-hydroxycarbamimidoyl)phenyl]acetate
SMILESCOC(=O)Cc1ccc(C(N)=NO)cc1Cl
InChIInChI=1S/C10H11ClN2O3/c1-16-9(14)5-6-2-3-7(4-8(6)11)10(12)13-15/h2-4,15H,5H2,1H3,(H2,12,13)
InChIKeyCBGAZBHCFLDYJU-UHFFFAOYSA-N
XLogP1.15
TPSA84.91 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.66
LogP ≤ 51.15
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze methyl 2-[2-chloro-4-(N'-hydroxycarbamimidoyl)phenyl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[2-chloro-4-(N'-hydroxycarbamimidoyl)phenyl]acetate?
The IUPAC name of methyl 2-[2-chloro-4-(N'-hydroxycarbamimidoyl)phenyl]acetate (CID 86683498) is methyl 2-[2-chloro-4-(N'-hydroxycarbamimidoyl)phenyl]acetate.
What is the SMILES notation for methyl 2-[2-chloro-4-(N'-hydroxycarbamimidoyl)phenyl]acetate?
The canonical SMILES for methyl 2-[2-chloro-4-(N'-hydroxycarbamimidoyl)phenyl]acetate is COC(=O)Cc1ccc(C(N)=NO)cc1Cl.
What is the InChIKey of methyl 2-[2-chloro-4-(N'-hydroxycarbamimidoyl)phenyl]acetate?
The InChIKey is CBGAZBHCFLDYJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClN2O3/c1-16-9(14)5-6-2-3-7(4-8(6)11)10(12)13-15/h2-4,15H,5H2,1H3,(H2,12,13).
What are the key properties of methyl 2-[2-chloro-4-(N'-hydroxycarbamimidoyl)phenyl]acetate?
methyl 2-[2-chloro-4-(N'-hydroxycarbamimidoyl)phenyl]acetate has a molecular weight of 242.66 g/mol, XLogP of 1.15, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-chloro-4-(N'-hydroxycarbamimidoyl)phenyl]acetate is sourced from PubChem (CID 86683498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).