C10H11ClN2O3 — CID 86683498
methyl 2-[2-chloro-4-(N'-hydroxycarbamimidoyl)phenyl]acetate (PubChem CID 86683498) has the molecular formula C10H11ClN2O3 and a molecular weight of 242.66 g/mol. Its IUPAC name is methyl 2-[2-chloro-4-(N'-hydroxycarbamimidoyl)phenyl]acetate.
| Compound Name | methyl 2-[2-chloro-4-(N'-hydroxycarbamimidoyl)phenyl]acetate |
|---|---|
| PubChem CID | 86683498 |
| Molecular Formula | C10H11ClN2O3 |
| Molecular Weight | 242.66 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | methyl 2-[2-chloro-4-(N'-hydroxycarbamimidoyl)phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(C(N)=NO)cc1Cl |
| InChI | InChI=1S/C10H11ClN2O3/c1-16-9(14)5-6-2-3-7(4-8(6)11)10(12)13-15/h2-4,15H,5H2,1H3,(H2,12,13) |
| InChIKey | CBGAZBHCFLDYJU-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.66 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|