C15H16N2O4 — CID 107730574
N-methyl-4-[(2,3,4-trihydroxyphenyl)methylamino]benzamide (PubChem CID 107730574) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is N-methyl-4-[(2,3,4-trihydroxyphenyl)methylamino]benzamide.
| Compound Name | N-methyl-4-[(2,3,4-trihydroxyphenyl)methylamino]benzamide |
|---|---|
| PubChem CID | 107730574 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | N-methyl-4-[(2,3,4-trihydroxyphenyl)methylamino]benzamide |
| SMILES | CNC(=O)c1ccc(NCc2ccc(O)c(O)c2O)cc1 |
| InChI | InChI=1S/C15H16N2O4/c1-16-15(21)9-2-5-11(6-3-9)17-8-10-4-7-12(18)14(20)13(10)19/h2-7,17-20H,8H2,1H3,(H,16,21) |
| InChIKey | OWQPFDBFBFZMGD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|