C10H11F3N2O — CID 59156701
N-methyl-4-(2,2,2-trifluoroethylamino)benzamide (PubChem CID 59156701) has the molecular formula C10H11F3N2O and a molecular weight of 232.20 g/mol. Its IUPAC name is N-methyl-4-(2,2,2-trifluoroethylamino)benzamide.
| Compound Name | N-methyl-4-(2,2,2-trifluoroethylamino)benzamide |
|---|---|
| PubChem CID | 59156701 |
| Molecular Formula | C10H11F3N2O |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | N-methyl-4-(2,2,2-trifluoroethylamino)benzamide |
| SMILES | CNC(=O)c1ccc(NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C10H11F3N2O/c1-14-9(16)7-2-4-8(5-3-7)15-6-10(11,12)13/h2-5,15H,6H2,1H3,(H,14,16) |
| InChIKey | PDRARORHSTXLNJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |