C10H10F4N2O — CID 59156732
3-fluoro-N-methyl-4-(2,2,2-trifluoroethylamino)benzamide (PubChem CID 59156732) has the molecular formula C10H10F4N2O and a molecular weight of 250.19 g/mol. Its IUPAC name is 3-fluoro-N-methyl-4-(2,2,2-trifluoroethylamino)benzamide.
| Compound Name | 3-fluoro-N-methyl-4-(2,2,2-trifluoroethylamino)benzamide |
|---|---|
| PubChem CID | 59156732 |
| Molecular Formula | C10H10F4N2O |
| Molecular Weight | 250.19 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 3-fluoro-N-methyl-4-(2,2,2-trifluoroethylamino)benzamide |
| SMILES | CNC(=O)c1ccc(NCC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C10H10F4N2O/c1-15-9(17)6-2-3-8(7(11)4-6)16-5-10(12,13)14/h2-4,16H,5H2,1H3,(H,15,17) |
| InChIKey | OUZWUPYKQFPXDD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.19 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |