About CID 167532226
CID 167532226 (PubChem CID 167532226) has the molecular formula C10H12BFNO
and a molecular weight of 192.02 g/mol.
Molecular Properties
| Compound Name | CID 167532226 |
| PubChem CID | 167532226 |
| Molecular Formula | C10H12BFNO |
| Molecular Weight | 192.02 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | — |
| SMILES | CCc1ccc(C(=O)NC)cc1F.[B] |
| InChI | InChI=1S/C10H12FNO.B/c1-3-7-4-5-8(6-9(7)11)10(13)12-2;/h4-6H,3H2,1-2H3,(H,12,13); |
| InChIKey | LSDBHMOVUMUHNH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.02 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 167532226 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167532226?
The IUPAC name of CID 167532226 (CID 167532226) is not available.
What is the SMILES notation for CID 167532226?
The canonical SMILES for CID 167532226 is CCc1ccc(C(=O)NC)cc1F.[B].
What is the InChIKey of CID 167532226?
The InChIKey is LSDBHMOVUMUHNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12FNO.B/c1-3-7-4-5-8(6-9(7)11)10(13)12-2;/h4-6H,3H2,1-2H3,(H,12,13);.
What are the key properties of CID 167532226?
CID 167532226 has a molecular weight of 192.02 g/mol, XLogP of 1.37, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167532226 is sourced from PubChem (CID 167532226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).