C12H12ClN3OS — CID 107095648
4-[(5-chloro-1,3-thiazol-2-yl)methylamino]-N-methylbenzamide (PubChem CID 107095648) has the molecular formula C12H12ClN3OS and a molecular weight of 281.77 g/mol. Its IUPAC name is 4-[(5-chloro-1,3-thiazol-2-yl)methylamino]-N-methylbenzamide.
| Compound Name | 4-[(5-chloro-1,3-thiazol-2-yl)methylamino]-N-methylbenzamide |
|---|---|
| PubChem CID | 107095648 |
| Molecular Formula | C12H12ClN3OS |
| Molecular Weight | 281.77 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 4-[(5-chloro-1,3-thiazol-2-yl)methylamino]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(NCc2ncc(Cl)s2)cc1 |
| InChI | InChI=1S/C12H12ClN3OS/c1-14-12(17)8-2-4-9(5-3-8)15-7-11-16-6-10(13)18-11/h2-6,15H,7H2,1H3,(H,14,17) |
| InChIKey | NQRAWRLJZIKWHB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.77 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |