C9H11ClO2 — CID 154435867
3-(chloromethyl)-4-ethylbenzene-1,2-diol (PubChem CID 154435867) has the molecular formula C9H11ClO2 and a molecular weight of 186.64 g/mol. Its IUPAC name is 3-(chloromethyl)-4-ethylbenzene-1,2-diol.
| Compound Name | 3-(chloromethyl)-4-ethylbenzene-1,2-diol |
|---|---|
| PubChem CID | 154435867 |
| Molecular Formula | C9H11ClO2 |
| Molecular Weight | 186.64 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | 3-(chloromethyl)-4-ethylbenzene-1,2-diol |
| SMILES | CCc1ccc(O)c(O)c1CCl |
| InChI | InChI=1S/C9H11ClO2/c1-2-6-3-4-8(11)9(12)7(6)5-10/h3-4,11-12H,2,5H2,1H3 |
| InChIKey | OODYFQHSTLFEJG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.64 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|