About calcium;butan-2-one;carbonate
calcium;butan-2-one;carbonate (PubChem CID 174893023) has the molecular formula C5H8CaO4
and a molecular weight of 172.19 g/mol. Its IUPAC name is calcium;butan-2-one;carbonate.
Molecular Properties
| Compound Name | calcium;butan-2-one;carbonate |
| PubChem CID | 174893023 |
| Molecular Formula | C5H8CaO4 |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.00 |
| IUPAC Name | calcium;butan-2-one;carbonate |
| SMILES | CCC(C)=O.O=C([O-])[O-].[Ca+2] |
| InChI | InChI=1S/C4H8O.CH2O3.Ca/c1-3-4(2)5;2-1(3)4;/h3H2,1-2H3;(H2,2,3,4);/q;;+2/p-2 |
| InChIKey | BLJLRWMRDAFZHY-UHFFFAOYSA-L |
| XLogP | -1.84 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze calcium;butan-2-one;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;butan-2-one;carbonate?
The IUPAC name of calcium;butan-2-one;carbonate (CID 174893023) is calcium;butan-2-one;carbonate.
What is the SMILES notation for calcium;butan-2-one;carbonate?
The canonical SMILES for calcium;butan-2-one;carbonate is CCC(C)=O.O=C([O-])[O-].[Ca+2].
What is the InChIKey of calcium;butan-2-one;carbonate?
The InChIKey is BLJLRWMRDAFZHY-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H8O.CH2O3.Ca/c1-3-4(2)5;2-1(3)4;/h3H2,1-2H3;(H2,2,3,4);/q;;+2/p-2.
What are the key properties of calcium;butan-2-one;carbonate?
calcium;butan-2-one;carbonate has a molecular weight of 172.19 g/mol, XLogP of -1.84, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;butan-2-one;carbonate is sourced from PubChem (CID 174893023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).