C24H16BrNO7 — CID 170414513
7-bromo-9-(3-phenylphenyl)carbazole-1,2,3,4,5,6,8-heptol (PubChem CID 170414513) has the molecular formula C24H16BrNO7 and a molecular weight of 510.30 g/mol. Its IUPAC name is 7-bromo-9-(3-phenylphenyl)carbazole-1,2,3,4,5,6,8-heptol.
| Compound Name | 7-bromo-9-(3-phenylphenyl)carbazole-1,2,3,4,5,6,8-heptol |
|---|---|
| PubChem CID | 170414513 |
| Molecular Formula | C24H16BrNO7 |
| Molecular Weight | 510.30 g/mol |
| Exact Mass | 509.01 |
| IUPAC Name | 7-bromo-9-(3-phenylphenyl)carbazole-1,2,3,4,5,6,8-heptol |
| SMILES | Oc1c(O)c(O)c2c(c1O)c1c(O)c(O)c(Br)c(O)c1n2-c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C24H16BrNO7/c25-15-20(29)16-13(18(27)21(15)30)14-17(22(31)24(33)23(32)19(14)28)26(16)12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9,27-33H |
| InChIKey | ZXFBYONYJUVQHX-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 146.54 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.30 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|