C17H16O2 — CID 98153987
(1R,12R)-3,10-dimethoxytetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10,13-hexaene (PubChem CID 98153987) has the molecular formula C17H16O2 and a molecular weight of 252.31 g/mol. Its IUPAC name is (1R,12R)-3,10-dimethoxytetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10,13-hexaene.
| Compound Name | (1R,12R)-3,10-dimethoxytetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10,13-hexaene |
|---|---|
| PubChem CID | 98153987 |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | (1R,12R)-3,10-dimethoxytetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10,13-hexaene |
| SMILES | COc1c2c(c(OC)c3ccccc13)[C@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C17H16O2/c1-18-16-12-5-3-4-6-13(12)17(19-2)15-11-8-7-10(9-11)14(15)16/h3-8,10-11H,9H2,1-2H3/t10-,11-/m0/s1 |
| InChIKey | MVNKVWQSNVLBIV-QWRGUYRKSA-N |
| XLogP | 4.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|