C15H12O2 — CID 58218990
(1R,12S)-tetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10,13-hexaene-3,10-diol (PubChem CID 58218990) has the molecular formula C15H12O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is (1R,12S)-tetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10,13-hexaene-3,10-diol.
| Compound Name | (1R,12S)-tetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10,13-hexaene-3,10-diol |
|---|---|
| PubChem CID | 58218990 |
| Molecular Formula | C15H12O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | (1R,12S)-tetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10,13-hexaene-3,10-diol |
| SMILES | Oc1c2c(c(O)c3ccccc13)[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C15H12O2/c16-14-10-3-1-2-4-11(10)15(17)13-9-6-5-8(7-9)12(13)14/h1-6,8-9,16-17H,7H2/t8-,9+ |
| InChIKey | OIVUMSUWJNHLQC-DTORHVGOSA-N |
| XLogP | 3.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|