C21H16Cl2O5 — CID 101057057
(1S,12R,13S,14R,16S,17R)-3,10-dimethoxy-15-oxahexacyclo[10.5.1.02,11.04,9.013,17.014,16]octadeca-2,4,6,8,10-pentaene-14,16-dicarbonyl chloride (PubChem CID 101057057) has the molecular formula C21H16Cl2O5 and a molecular weight of 419.26 g/mol. Its IUPAC name is (1S,12R,13S,14R,16S,17R)-3,10-dimethoxy-15-oxahexacyclo[10.5.1.02,11.04,9.013,17.014,16]octadeca-2,4,6,8,10-pentaene-14,16-dicarbonyl chloride.
| Compound Name | (1S,12R,13S,14R,16S,17R)-3,10-dimethoxy-15-oxahexacyclo[10.5.1.02,11.04,9.013,17.014,16]octadeca-2,4,6,8,10-pentaene-14,16-dicarbonyl chloride |
|---|---|
| PubChem CID | 101057057 |
| Molecular Formula | C21H16Cl2O5 |
| Molecular Weight | 419.26 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | (1S,12R,13S,14R,16S,17R)-3,10-dimethoxy-15-oxahexacyclo[10.5.1.02,11.04,9.013,17.014,16]octadeca-2,4,6,8,10-pentaene-14,16-dicarbonyl chloride |
| SMILES | COc1c2c(c(OC)c3ccccc13)[C@@H]1C[C@H]2[C@@H]2[C@H]1[C@@]1(C(=O)Cl)O[C@@]21C(=O)Cl |
| InChI | InChI=1S/C21H16Cl2O5/c1-26-16-8-5-3-4-6-9(8)17(27-2)13-11-7-10(12(13)16)14-15(11)21(19(23)25)20(14,28-21)18(22)24/h3-6,10-11,14-15H,7H2,1-2H3/t10-,11+,14-,15+,20-,21+ |
| InChIKey | BCICUJHWZBAOBI-SELXWKPPSA-N |
| XLogP | 3.73 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.26 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'cycloheptane_1', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|