C30H30O7 — CID 11272037
dimethyl (1S,2R,3S,4S,5S,8R,9R,10R,11S,12R)-14,21-dimethoxy-24-oxaoctacyclo[10.10.1.13,10.15,8.02,11.04,9.013,22.015,20]pentacosa-6,13,15,17,19,21-hexaene-3,10-dicarboxylate (PubChem CID 11272037) has the molecular formula C30H30O7 and a molecular weight of 502.56 g/mol. Its IUPAC name is dimethyl (1S,2R,3S,4S,5S,8R,9R,10R,11S,12R)-14,21-dimethoxy-24-oxaoctacyclo[10.10.1.13,10.15,8.02,11.04,9.013,22.015,20]pentacosa-6,13,15,17,19,21-hexaene-3,10-dicarboxylate.
| Compound Name | dimethyl (1S,2R,3S,4S,5S,8R,9R,10R,11S,12R)-14,21-dimethoxy-24-oxaoctacyclo[10.10.1.13,10.15,8.02,11.04,9.013,22.015,20]pentacosa-6,13,15,17,19,21-hexaene-3,10-dicarboxylate |
|---|---|
| PubChem CID | 11272037 |
| Molecular Formula | C30H30O7 |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | dimethyl (1S,2R,3S,4S,5S,8R,9R,10R,11S,12R)-14,21-dimethoxy-24-oxaoctacyclo[10.10.1.13,10.15,8.02,11.04,9.013,22.015,20]pentacosa-6,13,15,17,19,21-hexaene-3,10-dicarboxylate |
| SMILES | COC(=O)[C@@]12O[C@@](C(=O)OC)([C@@H]3[C@H]1[C@@H]1C[C@H]3c3c1c(OC)c1ccccc1c3OC)[C@H]1[C@@H]2[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C30H30O7/c1-33-25-15-7-5-6-8-16(15)26(34-2)20-18-12-17(19(20)25)23-24(18)30(28(32)36-4)22-14-10-9-13(11-14)21(22)29(23,37-30)27(31)35-3/h5-10,13-14,17-18,21-24H,11-12H2,1-4H3/t13-,14+,17-,18+,21+,22-,23-,24+,29+,30- |
| InChIKey | GMWMUXXHOSXGFP-BQFUXPKLSA-N |
| XLogP | 3.98 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|