C29H34O7 — CID 101057056
ditert-butyl (1S,12R,13S,14R,16S,17R)-3,10-dimethoxy-15-oxahexacyclo[10.5.1.02,11.04,9.013,17.014,16]octadeca-2,4,6,8,10-pentaene-14,16-dicarboxylate (PubChem CID 101057056) has the molecular formula C29H34O7 and a molecular weight of 494.58 g/mol. Its IUPAC name is ditert-butyl (1S,12R,13S,14R,16S,17R)-3,10-dimethoxy-15-oxahexacyclo[10.5.1.02,11.04,9.013,17.014,16]octadeca-2,4,6,8,10-pentaene-14,16-dicarboxylate.
| Compound Name | ditert-butyl (1S,12R,13S,14R,16S,17R)-3,10-dimethoxy-15-oxahexacyclo[10.5.1.02,11.04,9.013,17.014,16]octadeca-2,4,6,8,10-pentaene-14,16-dicarboxylate |
|---|---|
| PubChem CID | 101057056 |
| Molecular Formula | C29H34O7 |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | ditert-butyl (1S,12R,13S,14R,16S,17R)-3,10-dimethoxy-15-oxahexacyclo[10.5.1.02,11.04,9.013,17.014,16]octadeca-2,4,6,8,10-pentaene-14,16-dicarboxylate |
| SMILES | COc1c2c(c(OC)c3ccccc13)[C@@H]1C[C@H]2[C@@H]2[C@H]1[C@@]1(C(=O)OC(C)(C)C)O[C@@]21C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H34O7/c1-26(2,3)34-24(30)28-20-16-13-17(21(20)29(28,36-28)25(31)35-27(4,5)6)19-18(16)22(32-7)14-11-9-10-12-15(14)23(19)33-8/h9-12,16-17,20-21H,13H2,1-8H3/t16-,17+,20-,21+,28-,29+ |
| InChIKey | CKGDLEASIYJIQT-MPGNTFSZSA-N |
| XLogP | 4.88 |
| TPSA | 83.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cycloheptane_1', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|