C23H33NO8 — CID 10950448
ditert-butyl (1S,2S,3R,5S,6R,7S,8S)-8-[(2-methoxy-2-oxoethyl)carbamoyl]-4-oxatetracyclo[5.2.1.02,6.03,5]decane-3,5-dicarboxylate (PubChem CID 10950448) has the molecular formula C23H33NO8 and a molecular weight of 451.52 g/mol. Its IUPAC name is ditert-butyl (1S,2S,3R,5S,6R,7S,8S)-8-[(2-methoxy-2-oxoethyl)carbamoyl]-4-oxatetracyclo[5.2.1.02,6.03,5]decane-3,5-dicarboxylate.
| Compound Name | ditert-butyl (1S,2S,3R,5S,6R,7S,8S)-8-[(2-methoxy-2-oxoethyl)carbamoyl]-4-oxatetracyclo[5.2.1.02,6.03,5]decane-3,5-dicarboxylate |
|---|---|
| PubChem CID | 10950448 |
| Molecular Formula | C23H33NO8 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | ditert-butyl (1S,2S,3R,5S,6R,7S,8S)-8-[(2-methoxy-2-oxoethyl)carbamoyl]-4-oxatetracyclo[5.2.1.02,6.03,5]decane-3,5-dicarboxylate |
| SMILES | COC(=O)CNC(=O)[C@H]1C[C@@H]2C[C@H]1[C@@H]1[C@H]2[C@@]2(C(=O)OC(C)(C)C)O[C@@]12C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H33NO8/c1-20(2,3)30-18(27)22-15-11-8-12(13(9-11)17(26)24-10-14(25)29-7)16(15)23(22,32-22)19(28)31-21(4,5)6/h11-13,15-16H,8-10H2,1-7H3,(H,24,26)/t11-,12+,13-,15-,16+,22-,23+/m0/s1 |
| InChIKey | HCVGMHBPTPORJV-LXWPYDTPSA-N |
| XLogP | 1.37 |
| TPSA | 120.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cycloheptane_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|