C21H30N2O8 — CID 16725031
dimethyl (1S,2S,3R,5S,6R,7S,8S)-8-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoyl]-4-oxatetracyclo[5.2.1.02,6.03,5]decane-3,5-dicarboxylate (PubChem CID 16725031) has the molecular formula C21H30N2O8 and a molecular weight of 438.48 g/mol. Its IUPAC name is dimethyl (1S,2S,3R,5S,6R,7S,8S)-8-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoyl]-4-oxatetracyclo[5.2.1.02,6.03,5]decane-3,5-dicarboxylate.
| Compound Name | dimethyl (1S,2S,3R,5S,6R,7S,8S)-8-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoyl]-4-oxatetracyclo[5.2.1.02,6.03,5]decane-3,5-dicarboxylate |
|---|---|
| PubChem CID | 16725031 |
| Molecular Formula | C21H30N2O8 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | dimethyl (1S,2S,3R,5S,6R,7S,8S)-8-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoyl]-4-oxatetracyclo[5.2.1.02,6.03,5]decane-3,5-dicarboxylate |
| SMILES | COC(=O)[C@]12O[C@@]1(C(=O)OC)[C@@H]1[C@@H]3C[C@@H](C[C@@H]3C(=O)NCCNC(=O)OC(C)(C)C)[C@@H]12 |
| InChI | InChI=1S/C21H30N2O8/c1-19(2,3)30-18(27)23-7-6-22-15(24)12-9-10-8-11(12)14-13(10)20(16(25)28-4)21(14,31-20)17(26)29-5/h10-14H,6-9H2,1-5H3,(H,22,24)(H,23,27)/t10-,11+,12-,13-,14+,20-,21+/m0/s1 |
| InChIKey | KASSEASJOPQCBO-OMHKZZRQSA-N |
| XLogP | 0.38 |
| TPSA | 132.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cycloheptane_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|