C18H34N2O2 — CID 139428642
tert-butyl N-[2-[(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)amino]ethyl]carbamate (PubChem CID 139428642) has the molecular formula C18H34N2O2 and a molecular weight of 310.48 g/mol. Its IUPAC name is tert-butyl N-[2-[(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 139428642 |
| Molecular Formula | C18H34N2O2 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.26 |
| IUPAC Name | tert-butyl N-[2-[(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)amino]ethyl]carbamate |
| SMILES | CC1CC2CC(C)CC(NCCNC(=O)OC(C)(C)C)(C1)C2 |
| InChI | InChI=1S/C18H34N2O2/c1-13-8-15-9-14(2)11-18(10-13,12-15)20-7-6-19-16(21)22-17(3,4)5/h13-15,20H,6-12H2,1-5H3,(H,19,21) |
| InChIKey | GIKWVUIFCRFURB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|