C14H26N2O7 — CID 42602853
tert-butyl N-[2-[[(3R,5R)-1,3,4,5-tetrahydroxycyclohexanecarbonyl]amino]ethyl]carbamate (PubChem CID 42602853) has the molecular formula C14H26N2O7 and a molecular weight of 334.37 g/mol. Its IUPAC name is tert-butyl N-[2-[[(3R,5R)-1,3,4,5-tetrahydroxycyclohexanecarbonyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(3R,5R)-1,3,4,5-tetrahydroxycyclohexanecarbonyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 42602853 |
| Molecular Formula | C14H26N2O7 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | tert-butyl N-[2-[[(3R,5R)-1,3,4,5-tetrahydroxycyclohexanecarbonyl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)C1(O)C[C@@H](O)C(O)[C@H](O)C1 |
| InChI | InChI=1S/C14H26N2O7/c1-13(2,3)23-12(21)16-5-4-15-11(20)14(22)6-8(17)10(19)9(18)7-14/h8-10,17-19,22H,4-7H2,1-3H3,(H,15,20)(H,16,21)/t8-,9-,10?,14?/m1/s1 |
| InChIKey | YQONAVIMHHUJNX-QYAGFVFKSA-N |
| XLogP | -1.77 |
| TPSA | 148.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|