C13H26N2O3 — CID 103081858
tert-butyl N-[2-[(3-methoxycyclopentyl)amino]ethyl]carbamate (PubChem CID 103081858) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is tert-butyl N-[2-[(3-methoxycyclopentyl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(3-methoxycyclopentyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 103081858 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | tert-butyl N-[2-[(3-methoxycyclopentyl)amino]ethyl]carbamate |
| SMILES | COC1CCC(NCCNC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C13H26N2O3/c1-13(2,3)18-12(16)15-8-7-14-10-5-6-11(9-10)17-4/h10-11,14H,5-9H2,1-4H3,(H,15,16) |
| InChIKey | LGJQPWHFZCPUPR-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|