C22H46N2O3Si — CID 123710805
tert-butyl N-[2-[[4-tri(propan-2-yl)silyloxycyclohexyl]amino]ethyl]carbamate (PubChem CID 123710805) has the molecular formula C22H46N2O3Si and a molecular weight of 414.71 g/mol. Its IUPAC name is tert-butyl N-[2-[[4-tri(propan-2-yl)silyloxycyclohexyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[4-tri(propan-2-yl)silyloxycyclohexyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 123710805 |
| Molecular Formula | C22H46N2O3Si |
| Molecular Weight | 414.71 g/mol |
| Exact Mass | 414.33 |
| IUPAC Name | tert-butyl N-[2-[[4-tri(propan-2-yl)silyloxycyclohexyl]amino]ethyl]carbamate |
| SMILES | CC(C)[Si](OC1CCC(NCCNC(=O)OC(C)(C)C)CC1)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H46N2O3Si/c1-16(2)28(17(3)4,18(5)6)27-20-12-10-19(11-13-20)23-14-15-24-21(25)26-22(7,8)9/h16-20,23H,10-15H2,1-9H3,(H,24,25) |
| InChIKey | ZUBRGXSILBCWPX-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.71 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|