C16H30N2O3 — CID 99799409
tert-butyl N-[(E)-4-[(4-methoxycyclohexyl)amino]but-2-enyl]carbamate (PubChem CID 99799409) has the molecular formula C16H30N2O3 and a molecular weight of 298.43 g/mol. Its IUPAC name is tert-butyl N-[(E)-4-[(4-methoxycyclohexyl)amino]but-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(E)-4-[(4-methoxycyclohexyl)amino]but-2-enyl]carbamate |
|---|---|
| PubChem CID | 99799409 |
| Molecular Formula | C16H30N2O3 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | tert-butyl N-[(E)-4-[(4-methoxycyclohexyl)amino]but-2-enyl]carbamate |
| SMILES | COC1CCC(NC/C=C/CNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H30N2O3/c1-16(2,3)21-15(19)18-12-6-5-11-17-13-7-9-14(20-4)10-8-13/h5-6,13-14,17H,7-12H2,1-4H3,(H,18,19)/b6-5+ |
| InChIKey | SDNCKYQJCKSHRE-AATRIKPKSA-N |
| XLogP | 2.61 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|