C29H28O11 — CID 11295827
tetramethyl (1R,12S,13R,14R,17S,18S)-3,10-dimethoxy-20-oxahexacyclo[10.6.1.114,17.02,11.04,9.013,18]icosa-2,4,6,8,10,15-hexaene-14,15,16,17-tetracarboxylate (PubChem CID 11295827) has the molecular formula C29H28O11 and a molecular weight of 552.53 g/mol. Its IUPAC name is tetramethyl (1R,12S,13R,14R,17S,18S)-3,10-dimethoxy-20-oxahexacyclo[10.6.1.114,17.02,11.04,9.013,18]icosa-2,4,6,8,10,15-hexaene-14,15,16,17-tetracarboxylate.
| Compound Name | tetramethyl (1R,12S,13R,14R,17S,18S)-3,10-dimethoxy-20-oxahexacyclo[10.6.1.114,17.02,11.04,9.013,18]icosa-2,4,6,8,10,15-hexaene-14,15,16,17-tetracarboxylate |
|---|---|
| PubChem CID | 11295827 |
| Molecular Formula | C29H28O11 |
| Molecular Weight | 552.53 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | tetramethyl (1R,12S,13R,14R,17S,18S)-3,10-dimethoxy-20-oxahexacyclo[10.6.1.114,17.02,11.04,9.013,18]icosa-2,4,6,8,10,15-hexaene-14,15,16,17-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@]2(C(=O)OC)O[C@@]1(C(=O)OC)[C@@H]1[C@H]2[C@@H]2C[C@H]1c1c2c(OC)c2ccccc2c1OC |
| InChI | InChI=1S/C29H28O11/c1-34-22-12-9-7-8-10-13(12)23(35-2)17-15-11-14(16(17)22)18-19(15)29(27(33)39-6)21(25(31)37-4)20(24(30)36-3)28(18,40-29)26(32)38-5/h7-10,14-15,18-19H,11H2,1-6H3/t14-,15+,18-,19+,28-,29+ |
| InChIKey | BSDWZZFBUBAPKE-VYVAYDAZSA-N |
| XLogP | 2.18 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.53 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|